What is the chemical formula for 1-Iodopropane?

What is the chemical formula for 1-Iodopropane?

C3H7In-Propyl iodide / Formula

What is iodopropane?

Description. 1-Iodopropane is a natural product found in Mastocarpus stellatus, Ascophyllum nodosum, and other organisms with data available. LOTUS – the natural products occurrence database. Iodopropanes appears as a colorless liquid that discolors in air. Denser than water.

What is the structure of 2-Iodopropane?

C3H7IIsopropyl iodide / Formula

What is the condensed structural formula for 2-Iodopropane?

Identification of 2-IODOPROPANE Chemical Compound

Chemical Formula	C3H7I
IUPAC Name	2-iodopropane
SMILES String	CC(C)I
InChI	InChI=1S/C3H7I/c1-3(2)4/h3H,1-2H3
InChIKey	FMKOJHQHASLBPH-UHFFFAOYSA-N

Is 1 Iodopropane soluble in water?

n-Propyl iodide (also 1-propyl iodide or 1-iodopropane) is a colorless, flammable chemical compound….n-Propyl iodide.

Names
Melting point	−101.40 °C; −150.52 °F; 171.75 K
Boiling point	101.6 to 103.2 °C; 214.8 to 217.7 °F; 374.7 to 376.3 K
Solubility in water	1.1 g/L (at 20 °C)

How many structural isomers are possible for C3H7Cl?

Two structural isomers
How Many Structural Isomers Are Possible For A Compound With Molecular Formula C3H7Cl? Two structural isomers are possible for a compound with the molecular formula C3H7Cl. The two different structural isomers of a compound with molecular formula C3H7Cl are: 1-chloropropane and 2-chloropropane.

What is the condensed structural formula of 1 propanol?

An example of this is the difference between 1-propanol and 2-propanol (also known as isopropanol or rubbing alcohol)….

	1-propanol	2-propanol
condensed structural formula	CH3CH2CH2OH	CH3CHOHCH3
“stick figure”

What is the expanded structural formula for chloromethane?

CH3ClChloromethane / Formula

What is the IUPAC name of Cyclobutyl alcohol?

Cyclobutanol

Names
Preferred IUPAC name Cyclobutanol
Other names Cyclobutyl alcohol, Hydroxycyclobutane
Identifiers
CAS Number	2919-23-5